C30H31F6N3O4 — CID 139793685
2-(2,4-difluorophenyl)-3-methyl-4-[2-[4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]buta-1,3-dienyl]-1,3-dioxan-5-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 139793685) has the molecular formula C30H31F6N3O4 and a molecular weight of 611.58 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-3-methyl-4-[2-[4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]buta-1,3-dienyl]-1,3-dioxan-5-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-3-methyl-4-[2-[4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]buta-1,3-dienyl]-1,3-dioxan-5-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 139793685 |
| Molecular Formula | C30H31F6N3O4 |
| Molecular Weight | 611.58 g/mol |
| Exact Mass | 611.22 |
| IUPAC Name | 2-(2,4-difluorophenyl)-3-methyl-4-[2-[4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]buta-1,3-dienyl]-1,3-dioxan-5-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | CC(CC1COC(C=CC=Cc2ccc(OCC(F)(F)C(F)F)cc2)OC1)C(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C30H31F6N3O4/c1-20(29(40,16-39-19-37-18-38-39)25-11-8-23(31)13-26(25)32)12-22-14-41-27(42-15-22)5-3-2-4-21-6-9-24(10-7-21)43-17-30(35,36)28(33)34/h2-11,13,18-20,22,27-28,40H,12,14-17H2,1H3 |
| InChIKey | GPXLHBCTMYDLTL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.58 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|