C25H25ClF2N4O3S — CID 59972509
(3R)-3-[[2-[(1E,3E)-4-(6-chloro-3-pyridinyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 59972509) has the molecular formula C25H25ClF2N4O3S and a molecular weight of 535.02 g/mol. Its IUPAC name is (3R)-3-[[2-[(1E,3E)-4-(6-chloro-3-pyridinyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (3R)-3-[[2-[(1E,3E)-4-(6-chloro-3-pyridinyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 59972509 |
| Molecular Formula | C25H25ClF2N4O3S |
| Molecular Weight | 535.02 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | (3R)-3-[[2-[(1E,3E)-4-(6-chloro-3-pyridinyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | C[C@@H](SC1COC(/C=C/C=C/c2ccc(Cl)nc2)OC1)C(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C25H25ClF2N4O3S/c1-17(25(33,14-32-16-29-15-31-32)21-8-7-19(27)10-22(21)28)36-20-12-34-24(35-13-20)5-3-2-4-18-6-9-23(26)30-11-18/h2-11,15-17,20,24,33H,12-14H2,1H3/b4-2+,5-3+/t17-,20?,24?,25?/m1/s1 |
| InChIKey | AXOHNRWINOTXRI-RFDCMLDSSA-N |
| XLogP | 4.63 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.02 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|