C28H28F2N4O3 — CID 139793681
4-[(1E,3E)-4-[5-[(2S,3R)-3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butyl]-1,3-dioxan-2-yl]buta-1,3-dienyl]benzonitrile (PubChem CID 139793681) has the molecular formula C28H28F2N4O3 and a molecular weight of 506.55 g/mol. Its IUPAC name is 4-[(1E,3E)-4-[5-[(2S,3R)-3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butyl]-1,3-dioxan-2-yl]buta-1,3-dienyl]benzonitrile.
| Compound Name | 4-[(1E,3E)-4-[5-[(2S,3R)-3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butyl]-1,3-dioxan-2-yl]buta-1,3-dienyl]benzonitrile |
|---|---|
| PubChem CID | 139793681 |
| Molecular Formula | C28H28F2N4O3 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 4-[(1E,3E)-4-[5-[(2S,3R)-3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butyl]-1,3-dioxan-2-yl]buta-1,3-dienyl]benzonitrile |
| SMILES | C[C@@H](CC1COC(/C=C/C=C/c2ccc(C#N)cc2)OC1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C28H28F2N4O3/c1-20(28(35,17-34-19-32-18-33-34)25-11-10-24(29)13-26(25)30)12-23-15-36-27(37-16-23)5-3-2-4-21-6-8-22(14-31)9-7-21/h2-11,13,18-20,23,27,35H,12,15-17H2,1H3/b4-2+,5-3+/t20-,23?,27?,28+/m0/s1 |
| InChIKey | UEVDQCKQIKCLSB-UJWSCSSYSA-N |
| XLogP | 4.60 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|