C21H16F6N2O3 — CID 10623733
(2R)-1-(2,4-difluorophenyl)-2-[1-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazol-2-yl]oxypropan-1-one (PubChem CID 10623733) has the molecular formula C21H16F6N2O3 and a molecular weight of 458.36 g/mol. Its IUPAC name is (2R)-1-(2,4-difluorophenyl)-2-[1-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazol-2-yl]oxypropan-1-one.
| Compound Name | (2R)-1-(2,4-difluorophenyl)-2-[1-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazol-2-yl]oxypropan-1-one |
|---|---|
| PubChem CID | 10623733 |
| Molecular Formula | C21H16F6N2O3 |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | (2R)-1-(2,4-difluorophenyl)-2-[1-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazol-2-yl]oxypropan-1-one |
| SMILES | C[C@@H](Oc1nccn1-c1ccc(OCC(F)(F)C(F)F)cc1)C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H16F6N2O3/c1-12(18(30)16-7-2-13(22)10-17(16)23)32-20-28-8-9-29(20)14-3-5-15(6-4-14)31-11-21(26,27)19(24)25/h2-10,12,19H,11H2,1H3/t12-/m1/s1 |
| InChIKey | RNDNWYSTYRGTGW-GFCCVEGCSA-N |
| XLogP | 5.08 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|