C16H13BrF2O2 — CID 83136274
2-(4-bromo-3-methylphenoxy)-1-(2,4-difluorophenyl)propan-1-one (PubChem CID 83136274) has the molecular formula C16H13BrF2O2 and a molecular weight of 355.18 g/mol. Its IUPAC name is 2-(4-bromo-3-methylphenoxy)-1-(2,4-difluorophenyl)propan-1-one.
| Compound Name | 2-(4-bromo-3-methylphenoxy)-1-(2,4-difluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 83136274 |
| Molecular Formula | C16H13BrF2O2 |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 2-(4-bromo-3-methylphenoxy)-1-(2,4-difluorophenyl)propan-1-one |
| SMILES | Cc1cc(OC(C)C(=O)c2ccc(F)cc2F)ccc1Br |
| InChI | InChI=1S/C16H13BrF2O2/c1-9-7-12(4-6-14(9)17)21-10(2)16(20)13-5-3-11(18)8-15(13)19/h3-8,10H,1-2H3 |
| InChIKey | VSMXLVVQXGTJQQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |