C10H9F3N2O2S — CID 175835574
3-ethylsulfonyl-6-(trifluoromethyl)pyrazolo[1,5-a]pyridine (PubChem CID 175835574) has the molecular formula C10H9F3N2O2S and a molecular weight of 278.26 g/mol. Its IUPAC name is 3-ethylsulfonyl-6-(trifluoromethyl)pyrazolo[1,5-a]pyridine.
| Compound Name | 3-ethylsulfonyl-6-(trifluoromethyl)pyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 175835574 |
| Molecular Formula | C10H9F3N2O2S |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 3-ethylsulfonyl-6-(trifluoromethyl)pyrazolo[1,5-a]pyridine |
| SMILES | CCS(=O)(=O)c1cnn2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C10H9F3N2O2S/c1-2-18(16,17)9-5-14-15-6-7(10(11,12)13)3-4-8(9)15/h3-6H,2H2,1H3 |
| InChIKey | NLYYGDPWEXJMPX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |