C17H12F6N2O2S — CID 72704062
2-[2-ethylsulfonyl-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)indazole (PubChem CID 72704062) has the molecular formula C17H12F6N2O2S and a molecular weight of 422.35 g/mol. Its IUPAC name is 2-[2-ethylsulfonyl-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)indazole.
| Compound Name | 2-[2-ethylsulfonyl-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)indazole |
|---|---|
| PubChem CID | 72704062 |
| Molecular Formula | C17H12F6N2O2S |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 2-[2-ethylsulfonyl-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)indazole |
| SMILES | CCS(=O)(=O)c1cc(C(F)(F)F)ccc1-n1cc2ccc(C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C17H12F6N2O2S/c1-2-28(26,27)15-8-12(17(21,22)23)5-6-14(15)25-9-10-3-4-11(16(18,19)20)7-13(10)24-25/h3-9H,2H2,1H3 |
| InChIKey | BBKHXAODPSJMGB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |