C14H13F3N2O3S — CID 140939422
[2-[2-ethylsulfonyl-4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methanol (PubChem CID 140939422) has the molecular formula C14H13F3N2O3S and a molecular weight of 346.33 g/mol. Its IUPAC name is [2-[2-ethylsulfonyl-4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methanol.
| Compound Name | [2-[2-ethylsulfonyl-4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methanol |
|---|---|
| PubChem CID | 140939422 |
| Molecular Formula | C14H13F3N2O3S |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | [2-[2-ethylsulfonyl-4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methanol |
| SMILES | CCS(=O)(=O)c1cc(C(F)(F)F)ccc1-c1ncc(CO)cn1 |
| InChI | InChI=1S/C14H13F3N2O3S/c1-2-23(21,22)12-5-10(14(15,16)17)3-4-11(12)13-18-6-9(8-20)7-19-13/h3-7,20H,2,8H2,1H3 |
| InChIKey | UQLULMKYWCDOOP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |