C16H17F3N2O4S — CID 129248575
ethyl 2-[2-ethylsulfonyl-4-(trifluoromethyl)phenyl]-3-methylimidazole-4-carboxylate (PubChem CID 129248575) has the molecular formula C16H17F3N2O4S and a molecular weight of 390.38 g/mol. Its IUPAC name is ethyl 2-[2-ethylsulfonyl-4-(trifluoromethyl)phenyl]-3-methylimidazole-4-carboxylate.
| Compound Name | ethyl 2-[2-ethylsulfonyl-4-(trifluoromethyl)phenyl]-3-methylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 129248575 |
| Molecular Formula | C16H17F3N2O4S |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | ethyl 2-[2-ethylsulfonyl-4-(trifluoromethyl)phenyl]-3-methylimidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2ccc(C(F)(F)F)cc2S(=O)(=O)CC)n1C |
| InChI | InChI=1S/C16H17F3N2O4S/c1-4-25-15(22)12-9-20-14(21(12)3)11-7-6-10(16(17,18)19)8-13(11)26(23,24)5-2/h6-9H,4-5H2,1-3H3 |
| InChIKey | RSHQUIFAEDWBGQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |