C13H11F3N2O3S — CID 140928206
5-[2-ethylsulfonyl-4-(trifluoromethyl)phenyl]-1H-pyrazin-2-one (PubChem CID 140928206) has the molecular formula C13H11F3N2O3S and a molecular weight of 332.30 g/mol. Its IUPAC name is 5-[2-ethylsulfonyl-4-(trifluoromethyl)phenyl]-1H-pyrazin-2-one.
| Compound Name | 5-[2-ethylsulfonyl-4-(trifluoromethyl)phenyl]-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 140928206 |
| Molecular Formula | C13H11F3N2O3S |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 5-[2-ethylsulfonyl-4-(trifluoromethyl)phenyl]-1H-pyrazin-2-one |
| SMILES | CCS(=O)(=O)c1cc(C(F)(F)F)ccc1-c1c[nH]c(=O)cn1 |
| InChI | InChI=1S/C13H11F3N2O3S/c1-2-22(20,21)11-5-8(13(14,15)16)3-4-9(11)10-6-18-12(19)7-17-10/h3-7H,2H2,1H3,(H,18,19) |
| InChIKey | UDDBKDHEVNHOKE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |