5-(1,1-difluoroethyl)-3-ethylsulfonylpyridine-2-carboxylic acid

C10H11F2NO4S — CID 162442570

IUPAC5-(1,1-difluoroethyl)-3-ethylsulfonylpyridine-2-carboxylic acid
SMILESCCS(=O)(=O)c1cc(C(C)(F)F)cnc1C(=O)O
InChIInChI=1S/C10H11F2NO4S/c1-3-18(16,17)7-4-6(10(2,11)12)5-13-8(7)9(14)15/h4-5H,3H2,1-2H3,(H,14,15)
InChIKeyHQGJCCINGMLQNZ-UHFFFAOYSA-N
MW279.26 g/mol
LogP1.69
Rot. Bonds4

About 5-(1,1-difluoroethyl)-3-ethylsulfonylpyridine-2-carboxylic acid

5-(1,1-difluoroethyl)-3-ethylsulfonylpyridine-2-carboxylic acid (PubChem CID 162442570) has the molecular formula C10H11F2NO4S and a molecular weight of 279.26 g/mol. Its IUPAC name is 5-(1,1-difluoroethyl)-3-ethylsulfonylpyridine-2-carboxylic acid.

Molecular Properties

Compound Name5-(1,1-difluoroethyl)-3-ethylsulfonylpyridine-2-carboxylic acid
PubChem CID162442570
Molecular FormulaC10H11F2NO4S
Molecular Weight279.26 g/mol
Exact Mass279.04
IUPAC Name5-(1,1-difluoroethyl)-3-ethylsulfonylpyridine-2-carboxylic acid
SMILESCCS(=O)(=O)c1cc(C(C)(F)F)cnc1C(=O)O
InChIInChI=1S/C10H11F2NO4S/c1-3-18(16,17)7-4-6(10(2,11)12)5-13-8(7)9(14)15/h4-5H,3H2,1-2H3,(H,14,15)
InChIKeyHQGJCCINGMLQNZ-UHFFFAOYSA-N
XLogP1.69
TPSA84.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.26
LogP ≤ 51.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-(1,1-difluoroethyl)-3-ethylsulfonylpyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(1,1-difluoroethyl)-3-ethylsulfonylpyridine-2-carboxylic acid?
The IUPAC name of 5-(1,1-difluoroethyl)-3-ethylsulfonylpyridine-2-carboxylic acid (CID 162442570) is 5-(1,1-difluoroethyl)-3-ethylsulfonylpyridine-2-carboxylic acid.
What is the SMILES notation for 5-(1,1-difluoroethyl)-3-ethylsulfonylpyridine-2-carboxylic acid?
The canonical SMILES for 5-(1,1-difluoroethyl)-3-ethylsulfonylpyridine-2-carboxylic acid is CCS(=O)(=O)c1cc(C(C)(F)F)cnc1C(=O)O.
What is the InChIKey of 5-(1,1-difluoroethyl)-3-ethylsulfonylpyridine-2-carboxylic acid?
The InChIKey is HQGJCCINGMLQNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NO4S/c1-3-18(16,17)7-4-6(10(2,11)12)5-13-8(7)9(14)15/h4-5H,3H2,1-2H3,(H,14,15).
What are the key properties of 5-(1,1-difluoroethyl)-3-ethylsulfonylpyridine-2-carboxylic acid?
5-(1,1-difluoroethyl)-3-ethylsulfonylpyridine-2-carboxylic acid has a molecular weight of 279.26 g/mol, XLogP of 1.69, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,1-difluoroethyl)-3-ethylsulfonylpyridine-2-carboxylic acid is sourced from PubChem (CID 162442570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).