C10H11F2NO4S — CID 162442570
5-(1,1-difluoroethyl)-3-ethylsulfonylpyridine-2-carboxylic acid (PubChem CID 162442570) has the molecular formula C10H11F2NO4S and a molecular weight of 279.26 g/mol. Its IUPAC name is 5-(1,1-difluoroethyl)-3-ethylsulfonylpyridine-2-carboxylic acid.
| Compound Name | 5-(1,1-difluoroethyl)-3-ethylsulfonylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 162442570 |
| Molecular Formula | C10H11F2NO4S |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 5-(1,1-difluoroethyl)-3-ethylsulfonylpyridine-2-carboxylic acid |
| SMILES | CCS(=O)(=O)c1cc(C(C)(F)F)cnc1C(=O)O |
| InChI | InChI=1S/C10H11F2NO4S/c1-3-18(16,17)7-4-6(10(2,11)12)5-13-8(7)9(14)15/h4-5H,3H2,1-2H3,(H,14,15) |
| InChIKey | HQGJCCINGMLQNZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |