C8H6F3NO3S — CID 76963351
3-methylsulfinyl-5-(trifluoromethyl)pyridine-2-carboxylic acid (PubChem CID 76963351) has the molecular formula C8H6F3NO3S and a molecular weight of 253.20 g/mol. Its IUPAC name is 3-methylsulfinyl-5-(trifluoromethyl)pyridine-2-carboxylic acid.
| Compound Name | 3-methylsulfinyl-5-(trifluoromethyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 76963351 |
| Molecular Formula | C8H6F3NO3S |
| Molecular Weight | 253.20 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | 3-methylsulfinyl-5-(trifluoromethyl)pyridine-2-carboxylic acid |
| SMILES | CS(=O)c1cc(C(F)(F)F)cnc1C(=O)O |
| InChI | InChI=1S/C8H6F3NO3S/c1-16(15)5-2-4(8(9,10)11)3-12-6(5)7(13)14/h2-3H,1H3,(H,13,14) |
| InChIKey | RQFCURAIFZONFT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.20 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |