C11H16F3N3O3 — CID 174907680
hydrazine;3-(3-methoxypropyl)-5-(trifluoromethyl)pyridine-2-carboxylic acid (PubChem CID 174907680) has the molecular formula C11H16F3N3O3 and a molecular weight of 295.26 g/mol. Its IUPAC name is hydrazine;3-(3-methoxypropyl)-5-(trifluoromethyl)pyridine-2-carboxylic acid.
| Compound Name | hydrazine;3-(3-methoxypropyl)-5-(trifluoromethyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 174907680 |
| Molecular Formula | C11H16F3N3O3 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | hydrazine;3-(3-methoxypropyl)-5-(trifluoromethyl)pyridine-2-carboxylic acid |
| SMILES | COCCCc1cc(C(F)(F)F)cnc1C(=O)O.NN |
| InChI | InChI=1S/C11H12F3NO3.H4N2/c1-18-4-2-3-7-5-8(11(12,13)14)6-15-9(7)10(16)17;1-2/h5-6H,2-4H2,1H3,(H,16,17);1-2H2 |
| InChIKey | UMSFGNBCOZQXDL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 111.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|