C10H9F4NO2 — CID 133096484
ethyl 2-[2-fluoro-5-(trifluoromethyl)-3-pyridinyl]acetate (PubChem CID 133096484) has the molecular formula C10H9F4NO2 and a molecular weight of 251.18 g/mol. Its IUPAC name is ethyl 2-[2-fluoro-5-(trifluoromethyl)-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[2-fluoro-5-(trifluoromethyl)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 133096484 |
| Molecular Formula | C10H9F4NO2 |
| Molecular Weight | 251.18 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | ethyl 2-[2-fluoro-5-(trifluoromethyl)-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cc(C(F)(F)F)cnc1F |
| InChI | InChI=1S/C10H9F4NO2/c1-2-17-8(16)4-6-3-7(10(12,13)14)5-15-9(6)11/h3,5H,2,4H2,1H3 |
| InChIKey | KPOORAVJATXYOQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.18 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|