C14H17NO4S — CID 167547749
methyl 3-ethylsulfonyl-5-(2-methylbut-3-yn-2-yl)pyridine-2-carboxylate (PubChem CID 167547749) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is methyl 3-ethylsulfonyl-5-(2-methylbut-3-yn-2-yl)pyridine-2-carboxylate.
| Compound Name | methyl 3-ethylsulfonyl-5-(2-methylbut-3-yn-2-yl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 167547749 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | methyl 3-ethylsulfonyl-5-(2-methylbut-3-yn-2-yl)pyridine-2-carboxylate |
| SMILES | C#CC(C)(C)c1cnc(C(=O)OC)c(S(=O)(=O)CC)c1 |
| InChI | InChI=1S/C14H17NO4S/c1-6-14(3,4)10-8-11(20(17,18)7-2)12(15-9-10)13(16)19-5/h1,8-9H,7H2,2-5H3 |
| InChIKey | BZWPVTQABFIBNY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|