C13H12F3N3O4S — CID 174886144
3-amino-1-[2-ethylsulfonyl-4-(trifluoromethyl)phenyl]pyrazole-4-carboxylic acid (PubChem CID 174886144) has the molecular formula C13H12F3N3O4S and a molecular weight of 363.32 g/mol. Its IUPAC name is 3-amino-1-[2-ethylsulfonyl-4-(trifluoromethyl)phenyl]pyrazole-4-carboxylic acid.
| Compound Name | 3-amino-1-[2-ethylsulfonyl-4-(trifluoromethyl)phenyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 174886144 |
| Molecular Formula | C13H12F3N3O4S |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 3-amino-1-[2-ethylsulfonyl-4-(trifluoromethyl)phenyl]pyrazole-4-carboxylic acid |
| SMILES | CCS(=O)(=O)c1cc(C(F)(F)F)ccc1-n1cc(C(=O)O)c(N)n1 |
| InChI | InChI=1S/C13H12F3N3O4S/c1-2-24(22,23)10-5-7(13(14,15)16)3-4-9(10)19-6-8(12(20)21)11(17)18-19/h3-6H,2H2,1H3,(H2,17,18)(H,20,21) |
| InChIKey | SOOBTECPOBIVBG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |