C17H15F5N2O4S — CID 118535362
N-[5-(1,1-difluoroethyl)-1-hydroxy-2-pyridinylidene]-2-ethylsulfonyl-4-(trifluoromethyl)benzamide (PubChem CID 118535362) has the molecular formula C17H15F5N2O4S and a molecular weight of 438.37 g/mol. Its IUPAC name is N-[5-(1,1-difluoroethyl)-1-hydroxy-2-pyridinylidene]-2-ethylsulfonyl-4-(trifluoromethyl)benzamide.
| Compound Name | N-[5-(1,1-difluoroethyl)-1-hydroxy-2-pyridinylidene]-2-ethylsulfonyl-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 118535362 |
| Molecular Formula | C17H15F5N2O4S |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | N-[5-(1,1-difluoroethyl)-1-hydroxy-2-pyridinylidene]-2-ethylsulfonyl-4-(trifluoromethyl)benzamide |
| SMILES | CCS(=O)(=O)c1cc(C(F)(F)F)ccc1C(=O)/N=c1\ccc(C(C)(F)F)cn1O |
| InChI | InChI=1S/C17H15F5N2O4S/c1-3-29(27,28)13-8-10(17(20,21)22)4-6-12(13)15(25)23-14-7-5-11(9-24(14)26)16(2,18)19/h4-9,26H,3H2,1-2H3/b23-14+ |
| InChIKey | NCFLNUNISGAIGP-OEAKJJBVSA-N |
| XLogP | 3.39 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|