C11H9F3O4S — CID 54365557
3-[2-methylsulfonyl-4-(trifluoromethyl)phenyl]-3-oxopropanal (PubChem CID 54365557) has the molecular formula C11H9F3O4S and a molecular weight of 294.25 g/mol. Its IUPAC name is 3-[2-methylsulfonyl-4-(trifluoromethyl)phenyl]-3-oxopropanal.
| Compound Name | 3-[2-methylsulfonyl-4-(trifluoromethyl)phenyl]-3-oxopropanal |
|---|---|
| PubChem CID | 54365557 |
| Molecular Formula | C11H9F3O4S |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 3-[2-methylsulfonyl-4-(trifluoromethyl)phenyl]-3-oxopropanal |
| SMILES | CS(=O)(=O)c1cc(C(F)(F)F)ccc1C(=O)CC=O |
| InChI | InChI=1S/C11H9F3O4S/c1-19(17,18)10-6-7(11(12,13)14)2-3-8(10)9(16)4-5-15/h2-3,5-6H,4H2,1H3 |
| InChIKey | UPNGWNMNFJOBFM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|