C15H13ClF3NO4S — CID 151187137
[5-(3-chloropropyl)-1,2-oxazol-4-yl]-[2-methylsulfonyl-4-(trifluoromethyl)phenyl]methanone (PubChem CID 151187137) has the molecular formula C15H13ClF3NO4S and a molecular weight of 395.79 g/mol. Its IUPAC name is [5-(3-chloropropyl)-1,2-oxazol-4-yl]-[2-methylsulfonyl-4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [5-(3-chloropropyl)-1,2-oxazol-4-yl]-[2-methylsulfonyl-4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 151187137 |
| Molecular Formula | C15H13ClF3NO4S |
| Molecular Weight | 395.79 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | [5-(3-chloropropyl)-1,2-oxazol-4-yl]-[2-methylsulfonyl-4-(trifluoromethyl)phenyl]methanone |
| SMILES | CS(=O)(=O)c1cc(C(F)(F)F)ccc1C(=O)c1cnoc1CCCCl |
| InChI | InChI=1S/C15H13ClF3NO4S/c1-25(22,23)13-7-9(15(17,18)19)4-5-10(13)14(21)11-8-20-24-12(11)3-2-6-16/h4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | NFNRZQFGZXYQHK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 77.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.79 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|