C6H4F3IN2O2S — CID 131297996
2-iodo-5-(trifluoromethyl)pyridine-3-sulfonamide (PubChem CID 131297996) has the molecular formula C6H4F3IN2O2S and a molecular weight of 352.08 g/mol. Its IUPAC name is 2-iodo-5-(trifluoromethyl)pyridine-3-sulfonamide.
| Compound Name | 2-iodo-5-(trifluoromethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 131297996 |
| Molecular Formula | C6H4F3IN2O2S |
| Molecular Weight | 352.08 g/mol |
| Exact Mass | 351.90 |
| IUPAC Name | 2-iodo-5-(trifluoromethyl)pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(C(F)(F)F)cnc1I |
| InChI | InChI=1S/C6H4F3IN2O2S/c7-6(8,9)3-1-4(15(11,13)14)5(10)12-2-3/h1-2H,(H2,11,13,14) |
| InChIKey | GXLRCJQJIOZLRJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.08 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|