C13H12F3N3O2S — CID 155343072
2-methyl-4-[[5-(trifluoromethyl)-2-pyridinyl]amino]benzenesulfonamide (PubChem CID 155343072) has the molecular formula C13H12F3N3O2S and a molecular weight of 331.32 g/mol. Its IUPAC name is 2-methyl-4-[[5-(trifluoromethyl)-2-pyridinyl]amino]benzenesulfonamide.
| Compound Name | 2-methyl-4-[[5-(trifluoromethyl)-2-pyridinyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 155343072 |
| Molecular Formula | C13H12F3N3O2S |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 2-methyl-4-[[5-(trifluoromethyl)-2-pyridinyl]amino]benzenesulfonamide |
| SMILES | Cc1cc(Nc2ccc(C(F)(F)F)cn2)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C13H12F3N3O2S/c1-8-6-10(3-4-11(8)22(17,20)21)19-12-5-2-9(7-18-12)13(14,15)16/h2-7H,1H3,(H,18,19)(H2,17,20,21) |
| InChIKey | ZGARZFUBIXTUGH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |