C7H6ClF3N2O2S — CID 162420965
2-chloro-N-methyl-5-(trifluoromethyl)pyridine-3-sulfonamide (PubChem CID 162420965) has the molecular formula C7H6ClF3N2O2S and a molecular weight of 274.65 g/mol. Its IUPAC name is 2-chloro-N-methyl-5-(trifluoromethyl)pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-methyl-5-(trifluoromethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 162420965 |
| Molecular Formula | C7H6ClF3N2O2S |
| Molecular Weight | 274.65 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 2-chloro-N-methyl-5-(trifluoromethyl)pyridine-3-sulfonamide |
| SMILES | CNS(=O)(=O)c1cc(C(F)(F)F)cnc1Cl |
| InChI | InChI=1S/C7H6ClF3N2O2S/c1-12-16(14,15)5-2-4(7(9,10)11)3-13-6(5)8/h2-3,12H,1H3 |
| InChIKey | YZBIFPPQMFSKKT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.65 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|