C9H7F3N4O2S — CID 175751887
2-[4-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide (PubChem CID 175751887) has the molecular formula C9H7F3N4O2S and a molecular weight of 292.24 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide.
| Compound Name | 2-[4-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 175751887 |
| Molecular Formula | C9H7F3N4O2S |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 2-[4-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cccnc1-n1cc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C9H7F3N4O2S/c10-9(11,12)6-4-15-16(5-6)8-7(19(13,17)18)2-1-3-14-8/h1-5H,(H2,13,17,18) |
| InChIKey | QEKABKYZUAJYIU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |