C11H8F5N3O2S — CID 22415506
3-(1,1,2,2,2-pentafluoroethyl)-2-pyrazol-1-ylbenzenesulfonamide (PubChem CID 22415506) has the molecular formula C11H8F5N3O2S and a molecular weight of 341.26 g/mol. Its IUPAC name is 3-(1,1,2,2,2-pentafluoroethyl)-2-pyrazol-1-ylbenzenesulfonamide.
| Compound Name | 3-(1,1,2,2,2-pentafluoroethyl)-2-pyrazol-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 22415506 |
| Molecular Formula | C11H8F5N3O2S |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 3-(1,1,2,2,2-pentafluoroethyl)-2-pyrazol-1-ylbenzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(C(F)(F)C(F)(F)F)c1-n1cccn1 |
| InChI | InChI=1S/C11H8F5N3O2S/c12-10(13,11(14,15)16)7-3-1-4-8(22(17,20)21)9(7)19-6-2-5-18-19/h1-6H,(H2,17,20,21) |
| InChIKey | JDTURWVHAJLGSZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|