C12H3F15 — CID 123209727
1,2,3-tris(1,1,2,2,2-pentafluoroethyl)benzene (PubChem CID 123209727) has the molecular formula C12H3F15 and a molecular weight of 432.13 g/mol. Its IUPAC name is 1,2,3-tris(1,1,2,2,2-pentafluoroethyl)benzene.
| Compound Name | 1,2,3-tris(1,1,2,2,2-pentafluoroethyl)benzene |
|---|---|
| PubChem CID | 123209727 |
| Molecular Formula | C12H3F15 |
| Molecular Weight | 432.13 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | 1,2,3-tris(1,1,2,2,2-pentafluoroethyl)benzene |
| SMILES | FC(F)(F)C(F)(F)c1cccc(C(F)(F)C(F)(F)F)c1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H3F15/c13-7(14,10(19,20)21)4-2-1-3-5(8(15,16)11(22,23)24)6(4)9(17,18)12(25,26)27/h1-3H |
| InChIKey | TVJRHYXYRNVWOZ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.13 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|