C11H12F5N — CID 84729115
3-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]propan-1-amine (PubChem CID 84729115) has the molecular formula C11H12F5N and a molecular weight of 253.21 g/mol. Its IUPAC name is 3-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]propan-1-amine.
| Compound Name | 3-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 84729115 |
| Molecular Formula | C11H12F5N |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 3-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]propan-1-amine |
| SMILES | NCCCc1ccccc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H12F5N/c12-10(13,11(14,15)16)9-6-2-1-4-8(9)5-3-7-17/h1-2,4,6H,3,5,7,17H2 |
| InChIKey | UBFRLRADJILPNU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|