C16H8Cl4F3N3O2S — CID 22415459
2-pyrazol-1-yl-5-(2,3,4,5-tetrachlorophenyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 22415459) has the molecular formula C16H8Cl4F3N3O2S and a molecular weight of 505.13 g/mol. Its IUPAC name is 2-pyrazol-1-yl-5-(2,3,4,5-tetrachlorophenyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-pyrazol-1-yl-5-(2,3,4,5-tetrachlorophenyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22415459 |
| Molecular Formula | C16H8Cl4F3N3O2S |
| Molecular Weight | 505.13 g/mol |
| Exact Mass | 502.90 |
| IUPAC Name | 2-pyrazol-1-yl-5-(2,3,4,5-tetrachlorophenyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(-c2cc(Cl)c(Cl)c(Cl)c2Cl)cc(C(F)(F)F)c1-n1cccn1 |
| InChI | InChI=1S/C16H8Cl4F3N3O2S/c17-10-6-8(12(18)14(20)13(10)19)7-4-9(16(21,22)23)15(26-3-1-2-25-26)11(5-7)29(24,27)28/h1-6H,(H2,24,27,28) |
| InChIKey | NXBQTNJKXLDJAH-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.13 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|