C16H9F6N3O2S — CID 22420279
2-pyrazol-1-yl-3-(trifluoromethyl)-5-(3,4,5-trifluorophenyl)benzenesulfonamide (PubChem CID 22420279) has the molecular formula C16H9F6N3O2S and a molecular weight of 421.32 g/mol. Its IUPAC name is 2-pyrazol-1-yl-3-(trifluoromethyl)-5-(3,4,5-trifluorophenyl)benzenesulfonamide.
| Compound Name | 2-pyrazol-1-yl-3-(trifluoromethyl)-5-(3,4,5-trifluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22420279 |
| Molecular Formula | C16H9F6N3O2S |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | 2-pyrazol-1-yl-3-(trifluoromethyl)-5-(3,4,5-trifluorophenyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(-c2cc(F)c(F)c(F)c2)cc(C(F)(F)F)c1-n1cccn1 |
| InChI | InChI=1S/C16H9F6N3O2S/c17-11-5-9(6-12(18)14(11)19)8-4-10(16(20,21)22)15(25-3-1-2-24-25)13(7-8)28(23,26)27/h1-7H,(H2,23,26,27) |
| InChIKey | IDKGXUFAIWBSGR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|