C14H11F4NO2S — CID 166319735
3-[4-fluoro-3-methyl-5-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 166319735) has the molecular formula C14H11F4NO2S and a molecular weight of 333.31 g/mol. Its IUPAC name is 3-[4-fluoro-3-methyl-5-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 3-[4-fluoro-3-methyl-5-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 166319735 |
| Molecular Formula | C14H11F4NO2S |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 3-[4-fluoro-3-methyl-5-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | Cc1cc(-c2cccc(S(N)(=O)=O)c2)cc(C(F)(F)F)c1F |
| InChI | InChI=1S/C14H11F4NO2S/c1-8-5-10(7-12(13(8)15)14(16,17)18)9-3-2-4-11(6-9)22(19,20)21/h2-7H,1H3,(H2,19,20,21) |
| InChIKey | YSNGAAYWGKVTEV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |