C20H12F7NO2S — CID 23451063
4-[2,3,4,5-tetrafluoro-6-[4-methyl-3-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide (PubChem CID 23451063) has the molecular formula C20H12F7NO2S and a molecular weight of 463.37 g/mol. Its IUPAC name is 4-[2,3,4,5-tetrafluoro-6-[4-methyl-3-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide.
| Compound Name | 4-[2,3,4,5-tetrafluoro-6-[4-methyl-3-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 23451063 |
| Molecular Formula | C20H12F7NO2S |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | 4-[2,3,4,5-tetrafluoro-6-[4-methyl-3-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(-c2c(F)c(F)c(F)c(F)c2-c2ccc(S(N)(=O)=O)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H12F7NO2S/c1-9-2-3-11(8-13(9)20(25,26)27)15-14(16(21)18(23)19(24)17(15)22)10-4-6-12(7-5-10)31(28,29)30/h2-8H,1H3,(H2,28,29,30) |
| InChIKey | ZZCOBWNFMDCRNI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|