C42H28F6 — CID 129213075
9,10-bis[4-[4-methyl-3-(trifluoromethyl)phenyl]phenyl]anthracene (PubChem CID 129213075) has the molecular formula C42H28F6 and a molecular weight of 646.67 g/mol. Its IUPAC name is 9,10-bis[4-[4-methyl-3-(trifluoromethyl)phenyl]phenyl]anthracene.
| Compound Name | 9,10-bis[4-[4-methyl-3-(trifluoromethyl)phenyl]phenyl]anthracene |
|---|---|
| PubChem CID | 129213075 |
| Molecular Formula | C42H28F6 |
| Molecular Weight | 646.67 g/mol |
| Exact Mass | 646.21 |
| IUPAC Name | 9,10-bis[4-[4-methyl-3-(trifluoromethyl)phenyl]phenyl]anthracene |
| SMILES | Cc1ccc(-c2ccc(-c3c4ccccc4c(-c4ccc(-c5ccc(C)c(C(F)(F)F)c5)cc4)c4ccccc34)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C42H28F6/c1-25-11-13-31(23-37(25)41(43,44)45)27-15-19-29(20-16-27)39-33-7-3-5-9-35(33)40(36-10-6-4-8-34(36)39)30-21-17-28(18-22-30)32-14-12-26(2)38(24-32)42(46,47)48/h3-24H,1-2H3 |
| InChIKey | YQCDDEBALCLQLM-UHFFFAOYSA-N |
| XLogP | 13.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.67 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|