C34H28F6 — CID 129213068
2-tert-butyl-9,10-bis[4-methyl-3-(trifluoromethyl)phenyl]anthracene (PubChem CID 129213068) has the molecular formula C34H28F6 and a molecular weight of 550.59 g/mol. Its IUPAC name is 2-tert-butyl-9,10-bis[4-methyl-3-(trifluoromethyl)phenyl]anthracene.
| Compound Name | 2-tert-butyl-9,10-bis[4-methyl-3-(trifluoromethyl)phenyl]anthracene |
|---|---|
| PubChem CID | 129213068 |
| Molecular Formula | C34H28F6 |
| Molecular Weight | 550.59 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | 2-tert-butyl-9,10-bis[4-methyl-3-(trifluoromethyl)phenyl]anthracene |
| SMILES | Cc1ccc(-c2c3ccccc3c(-c3ccc(C)c(C(F)(F)F)c3)c3cc(C(C)(C)C)ccc23)cc1C(F)(F)F |
| InChI | InChI=1S/C34H28F6/c1-19-10-12-21(16-28(19)33(35,36)37)30-24-8-6-7-9-25(24)31(22-13-11-20(2)29(17-22)34(38,39)40)27-18-23(32(3,4)5)14-15-26(27)30/h6-18H,1-5H3 |
| InChIKey | OBHYKMQCNSGJAP-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.59 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|