About 9-(3,4-dimethylphenyl)-10-[4-methyl-3-(trifluoromethyl)phenyl]anthracene
9-(3,4-dimethylphenyl)-10-[4-methyl-3-(trifluoromethyl)phenyl]anthracene (PubChem CID 129212253) has the molecular formula C30H23F3
and a molecular weight of 440.51 g/mol. Its IUPAC name is 9-(3,4-dimethylphenyl)-10-[4-methyl-3-(trifluoromethyl)phenyl]anthracene.
Molecular Properties
| Compound Name | 9-(3,4-dimethylphenyl)-10-[4-methyl-3-(trifluoromethyl)phenyl]anthracene |
| PubChem CID | 129212253 |
| Molecular Formula | C30H23F3 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 9-(3,4-dimethylphenyl)-10-[4-methyl-3-(trifluoromethyl)phenyl]anthracene |
| SMILES | Cc1ccc(-c2c3ccccc3c(-c3ccc(C)c(C(F)(F)F)c3)c3ccccc23)cc1C |
| InChI | InChI=1S/C30H23F3/c1-18-12-14-21(16-20(18)3)28-23-8-4-6-10-25(23)29(26-11-7-5-9-24(26)28)22-15-13-19(2)27(17-22)30(31,32)33/h4-17H,1-3H3 |
| InChIKey | WNXCZFNZWHPIAC-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-(3,4-dimethylphenyl)-10-[4-methyl-3-(trifluoromethyl)phenyl]anthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(3,4-dimethylphenyl)-10-[4-methyl-3-(trifluoromethyl)phenyl]anthracene?
The IUPAC name of 9-(3,4-dimethylphenyl)-10-[4-methyl-3-(trifluoromethyl)phenyl]anthracene (CID 129212253) is 9-(3,4-dimethylphenyl)-10-[4-methyl-3-(trifluoromethyl)phenyl]anthracene.
What is the SMILES notation for 9-(3,4-dimethylphenyl)-10-[4-methyl-3-(trifluoromethyl)phenyl]anthracene?
The canonical SMILES for 9-(3,4-dimethylphenyl)-10-[4-methyl-3-(trifluoromethyl)phenyl]anthracene is Cc1ccc(-c2c3ccccc3c(-c3ccc(C)c(C(F)(F)F)c3)c3ccccc23)cc1C.
What is the InChIKey of 9-(3,4-dimethylphenyl)-10-[4-methyl-3-(trifluoromethyl)phenyl]anthracene?
The InChIKey is WNXCZFNZWHPIAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H23F3/c1-18-12-14-21(16-20(18)3)28-23-8-4-6-10-25(23)29(26-11-7-5-9-24(26)28)22-15-13-19(2)27(17-22)30(31,32)33/h4-17H,1-3H3.
What are the key properties of 9-(3,4-dimethylphenyl)-10-[4-methyl-3-(trifluoromethyl)phenyl]anthracene?
9-(3,4-dimethylphenyl)-10-[4-methyl-3-(trifluoromethyl)phenyl]anthracene has a molecular weight of 440.51 g/mol, XLogP of 9.27, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(3,4-dimethylphenyl)-10-[4-methyl-3-(trifluoromethyl)phenyl]anthracene is sourced from PubChem (CID 129212253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).