C23H17F3N2O2S — CID 68879538
3-[3-[3-methyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]benzenesulfonamide (PubChem CID 68879538) has the molecular formula C23H17F3N2O2S and a molecular weight of 442.46 g/mol. Its IUPAC name is 3-[3-[3-methyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]benzenesulfonamide.
| Compound Name | 3-[3-[3-methyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 68879538 |
| Molecular Formula | C23H17F3N2O2S |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 3-[3-[3-methyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]benzenesulfonamide |
| SMILES | Cc1cnc2c(C(F)(F)F)cccc2c1-c1cccc(-c2cccc(S(N)(=O)=O)c2)c1 |
| InChI | InChI=1S/C23H17F3N2O2S/c1-14-13-28-22-19(9-4-10-20(22)23(24,25)26)21(14)17-7-2-5-15(11-17)16-6-3-8-18(12-16)31(27,29)30/h2-13H,1H3,(H2,27,29,30) |
| InChIKey | SUFYDICYGRJNSF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |