C22H16F3NO2S2 — CID 68879022
3-methyl-4-[5-(3-methylsulfonylphenyl)thiophen-3-yl]-8-(trifluoromethyl)quinoline (PubChem CID 68879022) has the molecular formula C22H16F3NO2S2 and a molecular weight of 447.50 g/mol. Its IUPAC name is 3-methyl-4-[5-(3-methylsulfonylphenyl)thiophen-3-yl]-8-(trifluoromethyl)quinoline.
| Compound Name | 3-methyl-4-[5-(3-methylsulfonylphenyl)thiophen-3-yl]-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 68879022 |
| Molecular Formula | C22H16F3NO2S2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | 3-methyl-4-[5-(3-methylsulfonylphenyl)thiophen-3-yl]-8-(trifluoromethyl)quinoline |
| SMILES | Cc1cnc2c(C(F)(F)F)cccc2c1-c1csc(-c2cccc(S(C)(=O)=O)c2)c1 |
| InChI | InChI=1S/C22H16F3NO2S2/c1-13-11-26-21-17(7-4-8-18(21)22(23,24)25)20(13)15-10-19(29-12-15)14-5-3-6-16(9-14)30(2,27)28/h3-12H,1-2H3 |
| InChIKey | HMJOBOLNKGPQCI-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |