C25H20F3NO2S — CID 46887799
3-ethyl-4-[3-(3-methylsulfonylphenyl)phenyl]-8-(trifluoromethyl)quinoline (PubChem CID 46887799) has the molecular formula C25H20F3NO2S and a molecular weight of 455.50 g/mol. Its IUPAC name is 3-ethyl-4-[3-(3-methylsulfonylphenyl)phenyl]-8-(trifluoromethyl)quinoline.
| Compound Name | 3-ethyl-4-[3-(3-methylsulfonylphenyl)phenyl]-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 46887799 |
| Molecular Formula | C25H20F3NO2S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 3-ethyl-4-[3-(3-methylsulfonylphenyl)phenyl]-8-(trifluoromethyl)quinoline |
| SMILES | CCc1cnc2c(C(F)(F)F)cccc2c1-c1cccc(-c2cccc(S(C)(=O)=O)c2)c1 |
| InChI | InChI=1S/C25H20F3NO2S/c1-3-16-15-29-24-21(11-6-12-22(24)25(26,27)28)23(16)19-9-4-7-17(13-19)18-8-5-10-20(14-18)32(2,30)31/h4-15H,3H2,1-2H3 |
| InChIKey | DRNWBBRZORIYEI-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |