C26H22F3NO2S — CID 46887800
4-[3-(3-methylsulfonylphenyl)phenyl]-3-propyl-8-(trifluoromethyl)quinoline (PubChem CID 46887800) has the molecular formula C26H22F3NO2S and a molecular weight of 469.53 g/mol. Its IUPAC name is 4-[3-(3-methylsulfonylphenyl)phenyl]-3-propyl-8-(trifluoromethyl)quinoline.
| Compound Name | 4-[3-(3-methylsulfonylphenyl)phenyl]-3-propyl-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 46887800 |
| Molecular Formula | C26H22F3NO2S |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 4-[3-(3-methylsulfonylphenyl)phenyl]-3-propyl-8-(trifluoromethyl)quinoline |
| SMILES | CCCc1cnc2c(C(F)(F)F)cccc2c1-c1cccc(-c2cccc(S(C)(=O)=O)c2)c1 |
| InChI | InChI=1S/C26H22F3NO2S/c1-3-7-20-16-30-25-22(12-6-13-23(25)26(27,28)29)24(20)19-10-4-8-17(14-19)18-9-5-11-21(15-18)33(2,31)32/h4-6,8-16H,3,7H2,1-2H3 |
| InChIKey | DPAWQSUVLANLRD-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |