C25H20F3NO3S — CID 25102117
4-[3-(3-ethylsulfonylphenoxy)phenyl]-3-methyl-8-(trifluoromethyl)quinoline (PubChem CID 25102117) has the molecular formula C25H20F3NO3S and a molecular weight of 471.50 g/mol. Its IUPAC name is 4-[3-(3-ethylsulfonylphenoxy)phenyl]-3-methyl-8-(trifluoromethyl)quinoline.
| Compound Name | 4-[3-(3-ethylsulfonylphenoxy)phenyl]-3-methyl-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 25102117 |
| Molecular Formula | C25H20F3NO3S |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 4-[3-(3-ethylsulfonylphenoxy)phenyl]-3-methyl-8-(trifluoromethyl)quinoline |
| SMILES | CCS(=O)(=O)c1cccc(Oc2cccc(-c3c(C)cnc4c(C(F)(F)F)cccc34)c2)c1 |
| InChI | InChI=1S/C25H20F3NO3S/c1-3-33(30,31)20-10-5-9-19(14-20)32-18-8-4-7-17(13-18)23-16(2)15-29-24-21(23)11-6-12-22(24)25(26,27)28/h4-15H,3H2,1-2H3 |
| InChIKey | ZIMHQMXADUASSG-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |