C28H26F3NO3S — CID 25099839
3-methyl-4-[3-[3-(3-methylbutylsulfonyl)phenoxy]phenyl]-8-(trifluoromethyl)quinoline (PubChem CID 25099839) has the molecular formula C28H26F3NO3S and a molecular weight of 513.58 g/mol. Its IUPAC name is 3-methyl-4-[3-[3-(3-methylbutylsulfonyl)phenoxy]phenyl]-8-(trifluoromethyl)quinoline.
| Compound Name | 3-methyl-4-[3-[3-(3-methylbutylsulfonyl)phenoxy]phenyl]-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 25099839 |
| Molecular Formula | C28H26F3NO3S |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | 3-methyl-4-[3-[3-(3-methylbutylsulfonyl)phenoxy]phenyl]-8-(trifluoromethyl)quinoline |
| SMILES | Cc1cnc2c(C(F)(F)F)cccc2c1-c1cccc(Oc2cccc(S(=O)(=O)CCC(C)C)c2)c1 |
| InChI | InChI=1S/C28H26F3NO3S/c1-18(2)13-14-36(33,34)23-10-5-9-22(16-23)35-21-8-4-7-20(15-21)26-19(3)17-32-27-24(26)11-6-12-25(27)28(29,30)31/h4-12,15-18H,13-14H2,1-3H3 |
| InChIKey | MVQGOFQHJVGQCO-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |