C27H24F3NO4S — CID 25099991
4-[3-[3-(3-methoxypropylsulfonyl)phenoxy]phenyl]-3-methyl-8-(trifluoromethyl)quinoline (PubChem CID 25099991) has the molecular formula C27H24F3NO4S and a molecular weight of 515.55 g/mol. Its IUPAC name is 4-[3-[3-(3-methoxypropylsulfonyl)phenoxy]phenyl]-3-methyl-8-(trifluoromethyl)quinoline.
| Compound Name | 4-[3-[3-(3-methoxypropylsulfonyl)phenoxy]phenyl]-3-methyl-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 25099991 |
| Molecular Formula | C27H24F3NO4S |
| Molecular Weight | 515.55 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | 4-[3-[3-(3-methoxypropylsulfonyl)phenoxy]phenyl]-3-methyl-8-(trifluoromethyl)quinoline |
| SMILES | COCCCS(=O)(=O)c1cccc(Oc2cccc(-c3c(C)cnc4c(C(F)(F)F)cccc34)c2)c1 |
| InChI | InChI=1S/C27H24F3NO4S/c1-18-17-31-26-23(11-5-12-24(26)27(28,29)30)25(18)19-7-3-8-20(15-19)35-21-9-4-10-22(16-21)36(32,33)14-6-13-34-2/h3-5,7-12,15-17H,6,13-14H2,1-2H3 |
| InChIKey | PLHRETMILCOKED-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.55 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|