C23H23BF3NO2 — CID 68936837
3-methyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8-(trifluoromethyl)quinoline (PubChem CID 68936837) has the molecular formula C23H23BF3NO2 and a molecular weight of 413.25 g/mol. Its IUPAC name is 3-methyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8-(trifluoromethyl)quinoline.
| Compound Name | 3-methyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 68936837 |
| Molecular Formula | C23H23BF3NO2 |
| Molecular Weight | 413.25 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 3-methyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8-(trifluoromethyl)quinoline |
| SMILES | Cc1cnc2c(C(F)(F)F)cccc2c1-c1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C23H23BF3NO2/c1-14-13-28-20-17(10-7-11-18(20)23(25,26)27)19(14)15-8-6-9-16(12-15)24-29-21(2,3)22(4,5)30-24/h6-13H,1-5H3 |
| InChIKey | MJVHNFTVWTZGMH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.25 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|