C29H28F3NO4S — CID 68877643
1-[3-[3-[3-methyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]phenyl]sulfonylhexan-3-ol (PubChem CID 68877643) has the molecular formula C29H28F3NO4S and a molecular weight of 543.61 g/mol. Its IUPAC name is 1-[3-[3-[3-methyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]phenyl]sulfonylhexan-3-ol.
| Compound Name | 1-[3-[3-[3-methyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]phenyl]sulfonylhexan-3-ol |
|---|---|
| PubChem CID | 68877643 |
| Molecular Formula | C29H28F3NO4S |
| Molecular Weight | 543.61 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | 1-[3-[3-[3-methyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]phenyl]sulfonylhexan-3-ol |
| SMILES | CCCC(O)CCS(=O)(=O)c1cccc(Oc2cccc(-c3c(C)cnc4c(C(F)(F)F)cccc34)c2)c1 |
| InChI | InChI=1S/C29H28F3NO4S/c1-3-7-21(34)14-15-38(35,36)24-11-5-10-23(17-24)37-22-9-4-8-20(16-22)27-19(2)18-33-28-25(27)12-6-13-26(28)29(30,31)32/h4-6,8-13,16-18,21,34H,3,7,14-15H2,1-2H3 |
| InChIKey | RZKDPHQWTPTUQV-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.61 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |