C15H9F7N2O3S — CID 174965903
2-fluoro-N-(3-sulfamoylphenyl)-3,4-bis(trifluoromethyl)benzamide (PubChem CID 174965903) has the molecular formula C15H9F7N2O3S and a molecular weight of 430.30 g/mol. Its IUPAC name is 2-fluoro-N-(3-sulfamoylphenyl)-3,4-bis(trifluoromethyl)benzamide.
| Compound Name | 2-fluoro-N-(3-sulfamoylphenyl)-3,4-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 174965903 |
| Molecular Formula | C15H9F7N2O3S |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | 2-fluoro-N-(3-sulfamoylphenyl)-3,4-bis(trifluoromethyl)benzamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)c2ccc(C(F)(F)F)c(C(F)(F)F)c2F)c1 |
| InChI | InChI=1S/C15H9F7N2O3S/c16-12-9(4-5-10(14(17,18)19)11(12)15(20,21)22)13(25)24-7-2-1-3-8(6-7)28(23,26)27/h1-6H,(H,24,25)(H2,23,26,27) |
| InChIKey | QMVFUAHCBJIMJG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |