C12H15F2N3 — CID 164916885
3,5-difluoro-2-methyl-4-pyrazol-1-ylaniline;ethane (PubChem CID 164916885) has the molecular formula C12H15F2N3 and a molecular weight of 239.27 g/mol. Its IUPAC name is 3,5-difluoro-2-methyl-4-pyrazol-1-ylaniline;ethane.
| Compound Name | 3,5-difluoro-2-methyl-4-pyrazol-1-ylaniline;ethane |
|---|---|
| PubChem CID | 164916885 |
| Molecular Formula | C12H15F2N3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 3,5-difluoro-2-methyl-4-pyrazol-1-ylaniline;ethane |
| SMILES | CC.Cc1c(N)cc(F)c(-n2cccn2)c1F |
| InChI | InChI=1S/C10H9F2N3.C2H6/c1-6-8(13)5-7(11)10(9(6)12)15-4-2-3-14-15;1-2/h2-5H,13H2,1H3;1-2H3 |
| InChIKey | BIMGCBXZNMSGHH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|