C10H7BrF2N2 — CID 107085667
1-[4-(bromomethyl)-2,6-difluorophenyl]pyrazole (PubChem CID 107085667) has the molecular formula C10H7BrF2N2 and a molecular weight of 273.08 g/mol. Its IUPAC name is 1-[4-(bromomethyl)-2,6-difluorophenyl]pyrazole.
| Compound Name | 1-[4-(bromomethyl)-2,6-difluorophenyl]pyrazole |
|---|---|
| PubChem CID | 107085667 |
| Molecular Formula | C10H7BrF2N2 |
| Molecular Weight | 273.08 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 1-[4-(bromomethyl)-2,6-difluorophenyl]pyrazole |
| SMILES | Fc1cc(CBr)cc(F)c1-n1cccn1 |
| InChI | InChI=1S/C10H7BrF2N2/c11-6-7-4-8(12)10(9(13)5-7)15-3-1-2-14-15/h1-5H,6H2 |
| InChIKey | XPXUCTRMRHUIOI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.08 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|