C19H13F3N4O3S — CID 22313838
2-[5-[4-(furan-2-yl)phenyl]-3-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide (PubChem CID 22313838) has the molecular formula C19H13F3N4O3S and a molecular weight of 434.40 g/mol. Its IUPAC name is 2-[5-[4-(furan-2-yl)phenyl]-3-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide.
| Compound Name | 2-[5-[4-(furan-2-yl)phenyl]-3-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 22313838 |
| Molecular Formula | C19H13F3N4O3S |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 2-[5-[4-(furan-2-yl)phenyl]-3-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cccnc1-n1nc(C(F)(F)F)cc1-c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C19H13F3N4O3S/c20-19(21,22)17-11-14(12-5-7-13(8-6-12)15-3-2-10-29-15)26(25-17)18-16(30(23,27)28)4-1-9-24-18/h1-11H,(H2,23,27,28) |
| InChIKey | BSTSECDVBFTDLH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |