C8H6F3N5 — CID 102988586
3-[4-(trifluoromethyl)pyrazol-1-yl]pyrazin-2-amine (PubChem CID 102988586) has the molecular formula C8H6F3N5 and a molecular weight of 229.17 g/mol. Its IUPAC name is 3-[4-(trifluoromethyl)pyrazol-1-yl]pyrazin-2-amine.
| Compound Name | 3-[4-(trifluoromethyl)pyrazol-1-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 102988586 |
| Molecular Formula | C8H6F3N5 |
| Molecular Weight | 229.17 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 3-[4-(trifluoromethyl)pyrazol-1-yl]pyrazin-2-amine |
| SMILES | Nc1nccnc1-n1cc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C8H6F3N5/c9-8(10,11)5-3-15-16(4-5)7-6(12)13-1-2-14-7/h1-4H,(H2,12,13) |
| InChIKey | NVHRTERZSHYMET-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.17 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |