C32H22N4 — CID 54598071
N-(2,3-diphenylpyrido[3,4-b]pyrazin-8-yl)-1,1-diphenylmethanimine (PubChem CID 54598071) has the molecular formula C32H22N4 and a molecular weight of 462.56 g/mol. Its IUPAC name is N-(2,3-diphenylpyrido[3,4-b]pyrazin-8-yl)-1,1-diphenylmethanimine.
| Compound Name | N-(2,3-diphenylpyrido[3,4-b]pyrazin-8-yl)-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 54598071 |
| Molecular Formula | C32H22N4 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | N-(2,3-diphenylpyrido[3,4-b]pyrazin-8-yl)-1,1-diphenylmethanimine |
| SMILES | c1ccc(C(=Nc2cncc3nc(-c4ccccc4)c(-c4ccccc4)nc23)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H22N4/c1-5-13-23(14-6-1)29(24-15-7-2-8-16-24)34-27-21-33-22-28-32(27)36-31(26-19-11-4-12-20-26)30(35-28)25-17-9-3-10-18-25/h1-22H |
| InChIKey | WUDUSHIXLVDNAC-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 51.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|