C20H13F4NO — CID 169122838
N-[2-fluoro-4-(trifluoromethoxy)phenyl]-1,1-diphenylmethanimine (PubChem CID 169122838) has the molecular formula C20H13F4NO and a molecular weight of 359.32 g/mol. Its IUPAC name is N-[2-fluoro-4-(trifluoromethoxy)phenyl]-1,1-diphenylmethanimine.
| Compound Name | N-[2-fluoro-4-(trifluoromethoxy)phenyl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 169122838 |
| Molecular Formula | C20H13F4NO |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-[2-fluoro-4-(trifluoromethoxy)phenyl]-1,1-diphenylmethanimine |
| SMILES | Fc1cc(OC(F)(F)F)ccc1N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H13F4NO/c21-17-13-16(26-20(22,23)24)11-12-18(17)25-19(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13H |
| InChIKey | BGXFWEXNZZZRCT-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|