C11H10F4O2 — CID 170477398
4-[2-fluoro-4-(trifluoromethoxy)phenyl]but-3-en-1-ol (PubChem CID 170477398) has the molecular formula C11H10F4O2 and a molecular weight of 250.19 g/mol. Its IUPAC name is 4-[2-fluoro-4-(trifluoromethoxy)phenyl]but-3-en-1-ol.
| Compound Name | 4-[2-fluoro-4-(trifluoromethoxy)phenyl]but-3-en-1-ol |
|---|---|
| PubChem CID | 170477398 |
| Molecular Formula | C11H10F4O2 |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 4-[2-fluoro-4-(trifluoromethoxy)phenyl]but-3-en-1-ol |
| SMILES | OCCC=Cc1ccc(OC(F)(F)F)cc1F |
| InChI | InChI=1S/C11H10F4O2/c12-10-7-9(17-11(13,14)15)5-4-8(10)3-1-2-6-16/h1,3-5,7,16H,2,6H2 |
| InChIKey | JINAUPKUNMCQJN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |